C26H27N5O3 — CID 59268644
1-[4-[2-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]ethyl]phenyl]-3-phenylurea (PubChem CID 59268644) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-[4-[2-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]ethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[2-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]ethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 59268644 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-[4-[2-[(6,7-dimethoxyquinazolin-4-yl)-methylamino]ethyl]phenyl]-3-phenylurea |
| SMILES | COc1cc2ncnc(N(C)CCc3ccc(NC(=O)Nc4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C26H27N5O3/c1-31(25-21-15-23(33-2)24(34-3)16-22(21)27-17-28-25)14-13-18-9-11-20(12-10-18)30-26(32)29-19-7-5-4-6-8-19/h4-12,15-17H,13-14H2,1-3H3,(H2,29,30,32) |
| InChIKey | PWMZAKIHOOROKT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |