C23H23N7O3 — CID 59268828
1-[5-[2-[(6,7-dimethoxyquinazolin-4-yl)amino]ethyl]pyrimidin-2-yl]-3-phenylurea (PubChem CID 59268828) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-[5-[2-[(6,7-dimethoxyquinazolin-4-yl)amino]ethyl]pyrimidin-2-yl]-3-phenylurea.
| Compound Name | 1-[5-[2-[(6,7-dimethoxyquinazolin-4-yl)amino]ethyl]pyrimidin-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 59268828 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-[5-[2-[(6,7-dimethoxyquinazolin-4-yl)amino]ethyl]pyrimidin-2-yl]-3-phenylurea |
| SMILES | COc1cc2ncnc(NCCc3cnc(NC(=O)Nc4ccccc4)nc3)c2cc1OC |
| InChI | InChI=1S/C23H23N7O3/c1-32-19-10-17-18(11-20(19)33-2)27-14-28-21(17)24-9-8-15-12-25-22(26-13-15)30-23(31)29-16-6-4-3-5-7-16/h3-7,10-14H,8-9H2,1-2H3,(H,24,27,28)(H2,25,26,29,30,31) |
| InChIKey | JBTHNTBVGKGXKG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |