C18H17BrN2O2 — CID 22663169
4-(3-bromophenyl)-6,7-diethoxyquinazoline (PubChem CID 22663169) has the molecular formula C18H17BrN2O2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 4-(3-bromophenyl)-6,7-diethoxyquinazoline.
| Compound Name | 4-(3-bromophenyl)-6,7-diethoxyquinazoline |
|---|---|
| PubChem CID | 22663169 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 4-(3-bromophenyl)-6,7-diethoxyquinazoline |
| SMILES | CCOc1cc2ncnc(-c3cccc(Br)c3)c2cc1OCC |
| InChI | InChI=1S/C18H17BrN2O2/c1-3-22-16-9-14-15(10-17(16)23-4-2)20-11-21-18(14)12-6-5-7-13(19)8-12/h5-11H,3-4H2,1-2H3 |
| InChIKey | HDTAZRUUXZWWEU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |