C19H20FN3O4 — CID 57300434
N-(2-fluoro-4-methylphenyl)-N-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]hydroxylamine (PubChem CID 57300434) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-N-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]hydroxylamine.
| Compound Name | N-(2-fluoro-4-methylphenyl)-N-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]hydroxylamine |
|---|---|
| PubChem CID | 57300434 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-N-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]hydroxylamine |
| SMILES | COCCOc1cc2ncnc(N(O)c3ccc(C)cc3F)c2cc1OC |
| InChI | InChI=1S/C19H20FN3O4/c1-12-4-5-16(14(20)8-12)23(24)19-13-9-17(26-3)18(27-7-6-25-2)10-15(13)21-11-22-19/h4-5,8-11,24H,6-7H2,1-3H3 |
| InChIKey | OEHJNMXSBZHQQE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|