C23H26N3O4P — CID 123879489
N-(3-ethynyl-4-methylphenyl)-6,7-bis(2-methoxyethoxy)-N-phosphanylquinazolin-4-amine (PubChem CID 123879489) has the molecular formula C23H26N3O4P and a molecular weight of 439.45 g/mol. Its IUPAC name is N-(3-ethynyl-4-methylphenyl)-6,7-bis(2-methoxyethoxy)-N-phosphanylquinazolin-4-amine.
| Compound Name | N-(3-ethynyl-4-methylphenyl)-6,7-bis(2-methoxyethoxy)-N-phosphanylquinazolin-4-amine |
|---|---|
| PubChem CID | 123879489 |
| Molecular Formula | C23H26N3O4P |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(3-ethynyl-4-methylphenyl)-6,7-bis(2-methoxyethoxy)-N-phosphanylquinazolin-4-amine |
| SMILES | C#Cc1cc(N(P)c2ncnc3cc(OCCOC)c(OCCOC)cc23)ccc1C |
| InChI | InChI=1S/C23H26N3O4P/c1-5-17-12-18(7-6-16(17)2)26(31)23-19-13-21(29-10-8-27-3)22(30-11-9-28-4)14-20(19)24-15-25-23/h1,6-7,12-15H,8-11,31H2,2-4H3 |
| InChIKey | GPEOETBJNNFXKG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|