C25H29N3O5 — CID 87444104
N-[2-(3-ethynylphenyl)-2-methoxyethyl]-6,7-bis(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 87444104) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is N-[2-(3-ethynylphenyl)-2-methoxyethyl]-6,7-bis(2-methoxyethoxy)quinazolin-4-amine.
| Compound Name | N-[2-(3-ethynylphenyl)-2-methoxyethyl]-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 87444104 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-[2-(3-ethynylphenyl)-2-methoxyethyl]-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | C#Cc1cccc(C(CNc2ncnc3cc(OCCOC)c(OCCOC)cc23)OC)c1 |
| InChI | InChI=1S/C25H29N3O5/c1-5-18-7-6-8-19(13-18)24(31-4)16-26-25-20-14-22(32-11-9-29-2)23(33-12-10-30-3)15-21(20)27-17-28-25/h1,6-8,13-15,17,24H,9-12,16H2,2-4H3,(H,26,27,28) |
| InChIKey | UNMVKOXTQOVRHY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|