C21H23FN4O4 — CID 127028037
6-[4-(2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyhexanamide (PubChem CID 127028037) has the molecular formula C21H23FN4O4 and a molecular weight of 414.44 g/mol. Its IUPAC name is 6-[4-(2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyhexanamide.
| Compound Name | 6-[4-(2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 127028037 |
| Molecular Formula | C21H23FN4O4 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 6-[4-(2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxyhexanamide |
| SMILES | COc1cc2ncnc(Nc3ccccc3F)c2cc1OCCCCCC(=O)NO |
| InChI | InChI=1S/C21H23FN4O4/c1-29-18-12-17-14(11-19(18)30-10-6-2-3-9-20(27)26-28)21(24-13-23-17)25-16-8-5-4-7-15(16)22/h4-5,7-8,11-13,28H,2-3,6,9-10H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | WOTTWZMEGNRKBY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|