C27H33FN4O3 — CID 143778160
7-[4-[2-fluoro-4-methyl-3-(2-methylprop-1-enyl)anilino]-6-methoxyquinazolin-7-yl]oxyheptanamide (PubChem CID 143778160) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is 7-[4-[2-fluoro-4-methyl-3-(2-methylprop-1-enyl)anilino]-6-methoxyquinazolin-7-yl]oxyheptanamide.
| Compound Name | 7-[4-[2-fluoro-4-methyl-3-(2-methylprop-1-enyl)anilino]-6-methoxyquinazolin-7-yl]oxyheptanamide |
|---|---|
| PubChem CID | 143778160 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 7-[4-[2-fluoro-4-methyl-3-(2-methylprop-1-enyl)anilino]-6-methoxyquinazolin-7-yl]oxyheptanamide |
| SMILES | COc1cc2c(Nc3ccc(C)c(C=C(C)C)c3F)ncnc2cc1OCCCCCCC(N)=O |
| InChI | InChI=1S/C27H33FN4O3/c1-17(2)13-19-18(3)10-11-21(26(19)28)32-27-20-14-23(34-4)24(15-22(20)30-16-31-27)35-12-8-6-5-7-9-25(29)33/h10-11,13-16H,5-9,12H2,1-4H3,(H2,29,33)(H,30,31,32) |
| InChIKey | RZESKYQXNUUGLT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|