C30H37ClFN5O3 — CID 143782898
8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxybut-2-en-2-yl]amino]-9-methyldec-8-enamide (PubChem CID 143782898) has the molecular formula C30H37ClFN5O3 and a molecular weight of 570.11 g/mol. Its IUPAC name is 8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxybut-2-en-2-yl]amino]-9-methyldec-8-enamide.
| Compound Name | 8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxybut-2-en-2-yl]amino]-9-methyldec-8-enamide |
|---|---|
| PubChem CID | 143782898 |
| Molecular Formula | C30H37ClFN5O3 |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxybut-2-en-2-yl]amino]-9-methyldec-8-enamide |
| SMILES | C/C=C(/COc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC)NC(CCCCCCC(N)=O)=C(C)C |
| InChI | InChI=1S/C30H37ClFN5O3/c1-5-20(36-25(19(2)3)10-8-6-7-9-11-29(33)38)17-40-28-15-22-26(16-27(28)39-4)34-18-35-30(22)37-21-12-13-24(32)23(31)14-21/h5,12-16,18,36H,6-11,17H2,1-4H3,(H2,33,38)(H,34,35,37)/b20-5- |
| InChIKey | RDVMALBSKJUWQH-SDPNRITHSA-N |
| XLogP | 7.17 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|