C32H41ClFN7O3 — CID 143782834
8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-1-enyl]amino]non-8-enamide;1-methylazetidine-3-carboxamide (PubChem CID 143782834) has the molecular formula C32H41ClFN7O3 and a molecular weight of 626.18 g/mol. Its IUPAC name is 8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-1-enyl]amino]non-8-enamide;1-methylazetidine-3-carboxamide.
| Compound Name | 8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-1-enyl]amino]non-8-enamide;1-methylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 143782834 |
| Molecular Formula | C32H41ClFN7O3 |
| Molecular Weight | 626.18 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | 8-[[(Z)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]prop-1-enyl]amino]non-8-enamide;1-methylazetidine-3-carboxamide |
| SMILES | C=C(CCCCCCC(N)=O)N/C(=C\C)c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC.CN1CC(C(N)=O)C1 |
| InChI | InChI=1S/C27H31ClFN5O2.C5H10N2O/c1-4-23(33-17(2)9-7-5-6-8-10-26(30)35)19-14-20-24(15-25(19)36-3)31-16-32-27(20)34-18-11-12-22(29)21(28)13-18;1-7-2-4(3-7)5(6)8/h4,11-16,33H,2,5-10H2,1,3H3,(H2,30,35)(H,31,32,34);4H,2-3H2,1H3,(H2,6,8)/b23-4-; |
| InChIKey | DQMVLRRJTODVKE-GYQKROJHSA-N |
| XLogP | 5.50 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.18 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|