C32H33FN4O4 — CID 68676379
ethyl 6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]-7-phenylmethoxyquinazolin-6-yl]oxyhexanoate (PubChem CID 68676379) has the molecular formula C32H33FN4O4 and a molecular weight of 556.64 g/mol. Its IUPAC name is ethyl 6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]-7-phenylmethoxyquinazolin-6-yl]oxyhexanoate.
| Compound Name | ethyl 6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]-7-phenylmethoxyquinazolin-6-yl]oxyhexanoate |
|---|---|
| PubChem CID | 68676379 |
| Molecular Formula | C32H33FN4O4 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | ethyl 6-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)amino]-7-phenylmethoxyquinazolin-6-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc2c(Nc3ccc4[nH]c(C)cc4c3F)ncnc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C32H33FN4O4/c1-3-39-30(38)12-8-5-9-15-40-28-17-24-27(18-29(28)41-19-22-10-6-4-7-11-22)34-20-35-32(24)37-26-14-13-25-23(31(26)33)16-21(2)36-25/h4,6-7,10-11,13-14,16-18,20,36H,3,5,8-9,12,15,19H2,1-2H3,(H,34,35,37) |
| InChIKey | DZUKRVRWOKXZLY-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|