C23H17BrF4N4O2 — CID 118884446
1-(4-bromo-2-fluorophenyl)-1-[6-methoxy-7-[[4-(trifluoromethyl)phenyl]methoxy]quinazolin-4-yl]hydrazine (PubChem CID 118884446) has the molecular formula C23H17BrF4N4O2 and a molecular weight of 537.31 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-1-[6-methoxy-7-[[4-(trifluoromethyl)phenyl]methoxy]quinazolin-4-yl]hydrazine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-1-[6-methoxy-7-[[4-(trifluoromethyl)phenyl]methoxy]quinazolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 118884446 |
| Molecular Formula | C23H17BrF4N4O2 |
| Molecular Weight | 537.31 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-1-[6-methoxy-7-[[4-(trifluoromethyl)phenyl]methoxy]quinazolin-4-yl]hydrazine |
| SMILES | COc1cc2c(N(N)c3ccc(Br)cc3F)ncnc2cc1OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17BrF4N4O2/c1-33-20-9-16-18(10-21(20)34-11-13-2-4-14(5-3-13)23(26,27)28)30-12-31-22(16)32(29)19-7-6-15(24)8-17(19)25/h2-10,12H,11,29H2,1H3 |
| InChIKey | LDYFRLWJDWMHFH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.31 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|