About 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane
6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane (PubChem CID 143274794) has the molecular formula C16H24N2O5
and a molecular weight of 324.38 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane.
Molecular Properties
| Compound Name | 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane |
| PubChem CID | 143274794 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane |
| SMILES | CC.COCCOc1cc2nc[nH]c(=O)c2cc1OCCOC |
| InChI | InChI=1S/C14H18N2O5.C2H6/c1-18-3-5-20-12-7-10-11(15-9-16-14(10)17)8-13(12)21-6-4-19-2;1-2/h7-9H,3-6H2,1-2H3,(H,15,16,17);1-2H3 |
| InChIKey | MCCIAIWQICKJGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane?
The IUPAC name of 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane (CID 143274794) is 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane.
What is the SMILES notation for 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane?
The canonical SMILES for 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane is CC.COCCOc1cc2nc[nH]c(=O)c2cc1OCCOC.
What is the InChIKey of 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane?
The InChIKey is MCCIAIWQICKJGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O5.C2H6/c1-18-3-5-20-12-7-10-11(15-9-16-14(10)17)8-13(12)21-6-4-19-2;1-2/h7-9H,3-6H2,1-2H3,(H,15,16,17);1-2H3.
What are the key properties of 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane?
6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane has a molecular weight of 324.38 g/mol, XLogP of 2.00, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane is sourced from PubChem (CID 143274794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).