C16H24N2O5 — CID 143274794
6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane (PubChem CID 143274794) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane.
| Compound Name | 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane |
|---|---|
| PubChem CID | 143274794 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-3H-quinazolin-4-one;ethane |
| SMILES | CC.COCCOc1cc2nc[nH]c(=O)c2cc1OCCOC |
| InChI | InChI=1S/C14H18N2O5.C2H6/c1-18-3-5-20-12-7-10-11(15-9-16-14(10)17)8-13(12)21-6-4-19-2;1-2/h7-9H,3-6H2,1-2H3,(H,15,16,17);1-2H3 |
| InChIKey | MCCIAIWQICKJGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|