C12H15ClN2O3S — CID 135549386
6-methoxy-7-(2-methylsulfanylethoxy)-3H-quinazolin-4-one;hydrochloride (PubChem CID 135549386) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 6-methoxy-7-(2-methylsulfanylethoxy)-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 6-methoxy-7-(2-methylsulfanylethoxy)-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 135549386 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 6-methoxy-7-(2-methylsulfanylethoxy)-3H-quinazolin-4-one;hydrochloride |
| SMILES | COc1cc2c(=O)[nH]cnc2cc1OCCSC.Cl |
| InChI | InChI=1S/C12H14N2O3S.ClH/c1-16-10-5-8-9(13-7-14-12(8)15)6-11(10)17-3-4-18-2;/h5-7H,3-4H2,1-2H3,(H,13,14,15);1H |
| InChIKey | DBHJIMOGQLCBNO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|