C18H24N2O5 — CID 136597375
ethyl 7-[[4-oxo-7-(trideuteriomethoxy)-3H-quinazolin-6-yl]oxy]heptanoate (PubChem CID 136597375) has the molecular formula C18H24N2O5 and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl 7-[[4-oxo-7-(trideuteriomethoxy)-3H-quinazolin-6-yl]oxy]heptanoate.
| Compound Name | ethyl 7-[[4-oxo-7-(trideuteriomethoxy)-3H-quinazolin-6-yl]oxy]heptanoate |
|---|---|
| PubChem CID | 136597375 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | ethyl 7-[[4-oxo-7-(trideuteriomethoxy)-3H-quinazolin-6-yl]oxy]heptanoate |
| SMILES | [2H]C([2H])([2H])Oc1cc2nc[nH]c(=O)c2cc1OCCCCCCC(=O)OCC |
| InChI | InChI=1S/C18H24N2O5/c1-3-24-17(21)8-6-4-5-7-9-25-16-10-13-14(11-15(16)23-2)19-12-20-18(13)22/h10-12H,3-9H2,1-2H3,(H,19,20,22)/i2D3 |
| InChIKey | LGJBBWIUNZYXNM-BMSJAHLVSA-N |
| XLogP | 2.82 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|