C11H13N3O4 — CID 158241473
6,7-dimethoxy-3H-quinazolin-4-one;formamide (PubChem CID 158241473) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 6,7-dimethoxy-3H-quinazolin-4-one;formamide.
| Compound Name | 6,7-dimethoxy-3H-quinazolin-4-one;formamide |
|---|---|
| PubChem CID | 158241473 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6,7-dimethoxy-3H-quinazolin-4-one;formamide |
| SMILES | COc1cc2nc[nH]c(=O)c2cc1OC.NC=O |
| InChI | InChI=1S/C10H10N2O3.CH3NO/c1-14-8-3-6-7(4-9(8)15-2)11-5-12-10(6)13;2-1-3/h3-5H,1-2H3,(H,11,12,13);1H,(H2,2,3) |
| InChIKey | GFOZSNLCHNXDDF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|