C15H15N3O3 — CID 135442261
6-methoxy-7-(2-pyrrol-1-ylethoxy)-3H-quinazolin-4-one (PubChem CID 135442261) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-methoxy-7-(2-pyrrol-1-ylethoxy)-3H-quinazolin-4-one.
| Compound Name | 6-methoxy-7-(2-pyrrol-1-ylethoxy)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135442261 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 6-methoxy-7-(2-pyrrol-1-ylethoxy)-3H-quinazolin-4-one |
| SMILES | COc1cc2c(=O)[nH]cnc2cc1OCCn1cccc1 |
| InChI | InChI=1S/C15H15N3O3/c1-20-13-8-11-12(16-10-17-15(11)19)9-14(13)21-7-6-18-4-2-3-5-18/h2-5,8-10H,6-7H2,1H3,(H,16,17,19) |
| InChIKey | QVEMIVPOCFTULQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |