C19H23N3O5 — CID 141448946
ethyl (E)-8-[(7-methoxy-4-oxo-3H-quinazolin-6-yl)amino]-8-oxooct-6-enoate (PubChem CID 141448946) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl (E)-8-[(7-methoxy-4-oxo-3H-quinazolin-6-yl)amino]-8-oxooct-6-enoate.
| Compound Name | ethyl (E)-8-[(7-methoxy-4-oxo-3H-quinazolin-6-yl)amino]-8-oxooct-6-enoate |
|---|---|
| PubChem CID | 141448946 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | ethyl (E)-8-[(7-methoxy-4-oxo-3H-quinazolin-6-yl)amino]-8-oxooct-6-enoate |
| SMILES | CCOC(=O)CCCC/C=C/C(=O)Nc1cc2c(=O)[nH]cnc2cc1OC |
| InChI | InChI=1S/C19H23N3O5/c1-3-27-18(24)9-7-5-4-6-8-17(23)22-15-10-13-14(11-16(15)26-2)20-12-21-19(13)25/h6,8,10-12H,3-5,7,9H2,1-2H3,(H,22,23)(H,20,21,25)/b8-6+ |
| InChIKey | IDFWFZVAQCDBHU-SOFGYWHQSA-N |
| XLogP | 2.55 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|