C25H24F3N5O3 — CID 130205844
(E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-N',N'-dimethylbut-2-enehydrazide (PubChem CID 130205844) has the molecular formula C25H24F3N5O3 and a molecular weight of 499.49 g/mol. Its IUPAC name is (E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-N',N'-dimethylbut-2-enehydrazide.
| Compound Name | (E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-N',N'-dimethylbut-2-enehydrazide |
|---|---|
| PubChem CID | 130205844 |
| Molecular Formula | C25H24F3N5O3 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (E)-N-[7-[2-(difluoromethoxy)ethoxy]-4-(3-ethynyl-2-fluoroanilino)quinazolin-6-yl]-N',N'-dimethylbut-2-enehydrazide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC(F)F)c(N(C(=O)/C=C/C)N(C)C)cc23)c1F |
| InChI | InChI=1S/C25H24F3N5O3/c1-5-8-22(34)33(32(3)4)20-13-17-19(14-21(20)35-11-12-36-25(27)28)29-15-30-24(17)31-18-10-7-9-16(6-2)23(18)26/h2,5,7-10,13-15,25H,11-12H2,1,3-4H3,(H,29,30,31)/b8-5+ |
| InChIKey | MTEZSFSHYFWTTI-VMPITWQZSA-N |
| XLogP | 4.50 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|