C22H25ClFN5O3 — CID 11698329
(2R)-2-[[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]methyl-methylamino]propanamide (PubChem CID 11698329) has the molecular formula C22H25ClFN5O3 and a molecular weight of 461.93 g/mol. Its IUPAC name is (2R)-2-[[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]methyl-methylamino]propanamide.
| Compound Name | (2R)-2-[[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 11698329 |
| Molecular Formula | C22H25ClFN5O3 |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (2R)-2-[[4-(3-chloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]methyl-methylamino]propanamide |
| SMILES | COCCOc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1CN(C)[C@H](C)C(N)=O |
| InChI | InChI=1S/C22H25ClFN5O3/c1-13(21(25)30)29(2)11-14-9-15-18(10-19(14)32-8-7-31-3)26-12-27-22(15)28-17-6-4-5-16(23)20(17)24/h4-6,9-10,12-13H,7-8,11H2,1-3H3,(H2,25,30)(H,26,27,28)/t13-/m1/s1 |
| InChIKey | CMDRHYDZSFPUJJ-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|