C19H19ClFN5O2 — CID 141260195
(2S)-2-[[4-(3-chloro-2-fluoroanilino)-7-hydroxyquinazolin-6-yl]methyl-(deuteriomethyl)amino]propanamide (PubChem CID 141260195) has the molecular formula C19H19ClFN5O2 and a molecular weight of 404.85 g/mol. Its IUPAC name is (2S)-2-[[4-(3-chloro-2-fluoroanilino)-7-hydroxyquinazolin-6-yl]methyl-(deuteriomethyl)amino]propanamide.
| Compound Name | (2S)-2-[[4-(3-chloro-2-fluoroanilino)-7-hydroxyquinazolin-6-yl]methyl-(deuteriomethyl)amino]propanamide |
|---|---|
| PubChem CID | 141260195 |
| Molecular Formula | C19H19ClFN5O2 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (2S)-2-[[4-(3-chloro-2-fluoroanilino)-7-hydroxyquinazolin-6-yl]methyl-(deuteriomethyl)amino]propanamide |
| SMILES | [2H]CN(Cc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1O)[C@@H](C)C(N)=O |
| InChI | InChI=1S/C19H19ClFN5O2/c1-10(18(22)28)26(2)8-11-6-12-15(7-16(11)27)23-9-24-19(12)25-14-5-3-4-13(20)17(14)21/h3-7,9-10,27H,8H2,1-2H3,(H2,22,28)(H,23,24,25)/t10-/m0/s1/i2D |
| InChIKey | XTGGUBPMKCCYLE-HZQQZBLJSA-N |
| XLogP | 3.18 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|