C18H17ClFN5O2 — CID 69047706
2-amino-N-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]acetamide (PubChem CID 69047706) has the molecular formula C18H17ClFN5O2 and a molecular weight of 389.82 g/mol. Its IUPAC name is 2-amino-N-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]acetamide.
| Compound Name | 2-amino-N-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 69047706 |
| Molecular Formula | C18H17ClFN5O2 |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-amino-N-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]acetamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1CNC(=O)CN |
| InChI | InChI=1S/C18H17ClFN5O2/c1-27-15-6-14-11(5-10(15)8-22-16(26)7-21)18(24-9-23-14)25-13-4-2-3-12(19)17(13)20/h2-6,9H,7-8,21H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | NCPKYSZOPQLTCZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |