C21H21ClFN5O4 — CID 87879047
(2R)-1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-4-hydroperoxypyrrolidine-2-carboxamide (PubChem CID 87879047) has the molecular formula C21H21ClFN5O4 and a molecular weight of 461.88 g/mol. Its IUPAC name is (2R)-1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-4-hydroperoxypyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-4-hydroperoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87879047 |
| Molecular Formula | C21H21ClFN5O4 |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (2R)-1-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-4-hydroperoxypyrrolidine-2-carboxamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1CN1CC(OO)C[C@@H]1C(N)=O |
| InChI | InChI=1S/C21H21ClFN5O4/c1-31-18-7-16-13(5-11(18)8-28-9-12(32-30)6-17(28)20(24)29)21(26-10-25-16)27-15-4-2-3-14(22)19(15)23/h2-5,7,10,12,17,30H,6,8-9H2,1H3,(H2,24,29)(H,25,26,27)/t12?,17-/m1/s1 |
| InChIKey | BXLJFRBTSNSMKI-RGUGMKFQSA-N |
| XLogP | 3.09 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|