C15H21NO5 — CID 59442324
ethyl 2-[5-amino-2-(oxan-4-yloxy)phenoxy]acetate (PubChem CID 59442324) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 2-[5-amino-2-(oxan-4-yloxy)phenoxy]acetate.
| Compound Name | ethyl 2-[5-amino-2-(oxan-4-yloxy)phenoxy]acetate |
|---|---|
| PubChem CID | 59442324 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl 2-[5-amino-2-(oxan-4-yloxy)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C15H21NO5/c1-2-19-15(17)10-20-14-9-11(16)3-4-13(14)21-12-5-7-18-8-6-12/h3-4,9,12H,2,5-8,10,16H2,1H3 |
| InChIKey | KWEWXGROMUKZMI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|