C17H25NO4 — CID 59066570
methyl 4-(5-amino-2-cyclopentyloxyphenoxy)-3-methylbutanoate (PubChem CID 59066570) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 4-(5-amino-2-cyclopentyloxyphenoxy)-3-methylbutanoate.
| Compound Name | methyl 4-(5-amino-2-cyclopentyloxyphenoxy)-3-methylbutanoate |
|---|---|
| PubChem CID | 59066570 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | methyl 4-(5-amino-2-cyclopentyloxyphenoxy)-3-methylbutanoate |
| SMILES | COC(=O)CC(C)COc1cc(N)ccc1OC1CCCC1 |
| InChI | InChI=1S/C17H25NO4/c1-12(9-17(19)20-2)11-21-16-10-13(18)7-8-15(16)22-14-5-3-4-6-14/h7-8,10,12,14H,3-6,9,11,18H2,1-2H3 |
| InChIKey | IBNRAOKXDWATLK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|