C19H23NO2 — CID 164888754
4-cyclohexyloxy-3-phenylmethoxyaniline (PubChem CID 164888754) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-cyclohexyloxy-3-phenylmethoxyaniline.
| Compound Name | 4-cyclohexyloxy-3-phenylmethoxyaniline |
|---|---|
| PubChem CID | 164888754 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-cyclohexyloxy-3-phenylmethoxyaniline |
| SMILES | Nc1ccc(OC2CCCCC2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO2/c20-16-11-12-18(22-17-9-5-2-6-10-17)19(13-16)21-14-15-7-3-1-4-8-15/h1,3-4,7-8,11-13,17H,2,5-6,9-10,14,20H2 |
| InChIKey | IBBWTOROPZUFPX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|