C23H26O3 — CID 154984487
5-(3-cyclopentyloxy-4-phenylmethoxyphenyl)pent-1-en-3-one (PubChem CID 154984487) has the molecular formula C23H26O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 5-(3-cyclopentyloxy-4-phenylmethoxyphenyl)pent-1-en-3-one.
| Compound Name | 5-(3-cyclopentyloxy-4-phenylmethoxyphenyl)pent-1-en-3-one |
|---|---|
| PubChem CID | 154984487 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-(3-cyclopentyloxy-4-phenylmethoxyphenyl)pent-1-en-3-one |
| SMILES | C=CC(=O)CCc1ccc(OCc2ccccc2)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C23H26O3/c1-2-20(24)14-12-18-13-15-22(25-17-19-8-4-3-5-9-19)23(16-18)26-21-10-6-7-11-21/h2-5,8-9,13,15-16,21H,1,6-7,10-12,14,17H2 |
| InChIKey | NTDYGVMFQXIWBG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|