C25H24N2O5 — CID 90909409
5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-2-hydroxy-1,3-diazinane-4,6-dione (PubChem CID 90909409) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-2-hydroxy-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-2-hydroxy-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90909409 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 5-[[3,4-bis(phenylmethoxy)phenyl]methyl]-2-hydroxy-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(O)NC(=O)C1Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O5/c28-23-20(24(29)27-25(30)26-23)13-19-11-12-21(31-15-17-7-3-1-4-8-17)22(14-19)32-16-18-9-5-2-6-10-18/h1-12,14,20,25,30H,13,15-16H2,(H,26,28)(H,27,29) |
| InChIKey | LZPLLHYYVWLHOL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|