C21H22O2Si — CID 137330440
[3,4-bis(phenylmethoxy)phenyl]-methylsilane (PubChem CID 137330440) has the molecular formula C21H22O2Si and a molecular weight of 334.49 g/mol. Its IUPAC name is [3,4-bis(phenylmethoxy)phenyl]-methylsilane.
| Compound Name | [3,4-bis(phenylmethoxy)phenyl]-methylsilane |
|---|---|
| PubChem CID | 137330440 |
| Molecular Formula | C21H22O2Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [3,4-bis(phenylmethoxy)phenyl]-methylsilane |
| SMILES | C[SiH2]c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H22O2Si/c1-24-19-12-13-20(22-15-17-8-4-2-5-9-17)21(14-19)23-16-18-10-6-3-7-11-18/h2-14H,15-16,24H2,1H3 |
| InChIKey | ZMZXYWSWVAZULU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|