C26H28O4 — CID 157495437
1-[3,4-bis(phenylmethoxy)phenyl]-6-hydroxyhexan-3-one (PubChem CID 157495437) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1-[3,4-bis(phenylmethoxy)phenyl]-6-hydroxyhexan-3-one.
| Compound Name | 1-[3,4-bis(phenylmethoxy)phenyl]-6-hydroxyhexan-3-one |
|---|---|
| PubChem CID | 157495437 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[3,4-bis(phenylmethoxy)phenyl]-6-hydroxyhexan-3-one |
| SMILES | O=C(CCCO)CCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H28O4/c27-17-7-12-24(28)15-13-21-14-16-25(29-19-22-8-3-1-4-9-22)26(18-21)30-20-23-10-5-2-6-11-23/h1-6,8-11,14,16,18,27H,7,12-13,15,17,19-20H2 |
| InChIKey | AKOBYTLMZWTLFS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |