About 3-iodo-4-phenylmethoxyaniline;iron
3-iodo-4-phenylmethoxyaniline;iron (PubChem CID 70281064) has the molecular formula C13H12FeINO
and a molecular weight of 380.99 g/mol. Its IUPAC name is 3-iodo-4-phenylmethoxyaniline;iron.
Molecular Properties
| Compound Name | 3-iodo-4-phenylmethoxyaniline;iron |
| PubChem CID | 70281064 |
| Molecular Formula | C13H12FeINO |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | 3-iodo-4-phenylmethoxyaniline;iron |
| SMILES | Nc1ccc(OCc2ccccc2)c(I)c1.[Fe] |
| InChI | InChI=1S/C13H12INO.Fe/c14-12-8-11(15)6-7-13(12)16-9-10-4-2-1-3-5-10;/h1-8H,9,15H2; |
| InChIKey | PDGYUPHVDOEHPQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-4-phenylmethoxyaniline;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-4-phenylmethoxyaniline;iron?
The IUPAC name of 3-iodo-4-phenylmethoxyaniline;iron (CID 70281064) is 3-iodo-4-phenylmethoxyaniline;iron.
What is the SMILES notation for 3-iodo-4-phenylmethoxyaniline;iron?
The canonical SMILES for 3-iodo-4-phenylmethoxyaniline;iron is Nc1ccc(OCc2ccccc2)c(I)c1.[Fe].
What is the InChIKey of 3-iodo-4-phenylmethoxyaniline;iron?
The InChIKey is PDGYUPHVDOEHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12INO.Fe/c14-12-8-11(15)6-7-13(12)16-9-10-4-2-1-3-5-10;/h1-8H,9,15H2;.
What are the key properties of 3-iodo-4-phenylmethoxyaniline;iron?
3-iodo-4-phenylmethoxyaniline;iron has a molecular weight of 380.99 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-4-phenylmethoxyaniline;iron is sourced from PubChem (CID 70281064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).