C22H23NO4 — CID 175367557
6-cyclohexyloxy-4-phenylmethoxy-1H-indole-2-carboxylic acid (PubChem CID 175367557) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 6-cyclohexyloxy-4-phenylmethoxy-1H-indole-2-carboxylic acid.
| Compound Name | 6-cyclohexyloxy-4-phenylmethoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175367557 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 6-cyclohexyloxy-4-phenylmethoxy-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(OCc3ccccc3)cc(OC3CCCCC3)cc2[nH]1 |
| InChI | InChI=1S/C22H23NO4/c24-22(25)20-13-18-19(23-20)11-17(27-16-9-5-2-6-10-16)12-21(18)26-14-15-7-3-1-4-8-15/h1,3-4,7-8,11-13,16,23H,2,5-6,9-10,14H2,(H,24,25) |
| InChIKey | WTJKYGPBZLLKSS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |