C22H34N2O6 — CID 142076376
tert-butyl 4-[4-amino-2-(4-methoxy-2-methyl-4-oxobutoxy)phenoxy]piperidine-1-carboxylate (PubChem CID 142076376) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-2-(4-methoxy-2-methyl-4-oxobutoxy)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-2-(4-methoxy-2-methyl-4-oxobutoxy)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142076376 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | tert-butyl 4-[4-amino-2-(4-methoxy-2-methyl-4-oxobutoxy)phenoxy]piperidine-1-carboxylate |
| SMILES | COC(=O)CC(C)COc1cc(N)ccc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H34N2O6/c1-15(12-20(25)27-5)14-28-19-13-16(23)6-7-18(19)29-17-8-10-24(11-9-17)21(26)30-22(2,3)4/h6-7,13,15,17H,8-12,14,23H2,1-5H3 |
| InChIKey | VKUJLAJLTIIZCJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|