C16H22O6 — CID 117495301
ethyl 2-hydroxy-2-[4-methoxy-3-(oxan-4-yloxy)phenyl]acetate (PubChem CID 117495301) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-[4-methoxy-3-(oxan-4-yloxy)phenyl]acetate.
| Compound Name | ethyl 2-hydroxy-2-[4-methoxy-3-(oxan-4-yloxy)phenyl]acetate |
|---|---|
| PubChem CID | 117495301 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 2-hydroxy-2-[4-methoxy-3-(oxan-4-yloxy)phenyl]acetate |
| SMILES | CCOC(=O)C(O)c1ccc(OC)c(OC2CCOCC2)c1 |
| InChI | InChI=1S/C16H22O6/c1-3-21-16(18)15(17)11-4-5-13(19-2)14(10-11)22-12-6-8-20-9-7-12/h4-5,10,12,15,17H,3,6-9H2,1-2H3 |
| InChIKey | TXOFCKVPBZXZNK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |