C15H19N3O4S — CID 59442420
ethyl 2-[5-amino-2-[2-(1,3-thiazol-2-ylamino)ethoxy]phenoxy]acetate (PubChem CID 59442420) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is ethyl 2-[5-amino-2-[2-(1,3-thiazol-2-ylamino)ethoxy]phenoxy]acetate.
| Compound Name | ethyl 2-[5-amino-2-[2-(1,3-thiazol-2-ylamino)ethoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 59442420 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | ethyl 2-[5-amino-2-[2-(1,3-thiazol-2-ylamino)ethoxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(N)ccc1OCCNc1nccs1 |
| InChI | InChI=1S/C15H19N3O4S/c1-2-20-14(19)10-22-13-9-11(16)3-4-12(13)21-7-5-17-15-18-6-8-23-15/h3-4,6,8-9H,2,5,7,10,16H2,1H3,(H,17,18) |
| InChIKey | QGDOAGKUNPDQIZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|