C15H21IO4 — CID 101144940
2-[[3-methoxy-4-(1,1,2,2-tetradeuterio-2-iodoethoxy)phenyl]methoxy]oxane (PubChem CID 101144940) has the molecular formula C15H21IO4 and a molecular weight of 396.26 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(1,1,2,2-tetradeuterio-2-iodoethoxy)phenyl]methoxy]oxane.
| Compound Name | 2-[[3-methoxy-4-(1,1,2,2-tetradeuterio-2-iodoethoxy)phenyl]methoxy]oxane |
|---|---|
| PubChem CID | 101144940 |
| Molecular Formula | C15H21IO4 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-[[3-methoxy-4-(1,1,2,2-tetradeuterio-2-iodoethoxy)phenyl]methoxy]oxane |
| SMILES | [2H]C([2H])(I)C([2H])([2H])Oc1ccc(COC2CCCCO2)cc1OC |
| InChI | InChI=1S/C15H21IO4/c1-17-14-10-12(5-6-13(14)18-9-7-16)11-20-15-4-2-3-8-19-15/h5-6,10,15H,2-4,7-9,11H2,1H3/i7D2,9D2 |
| InChIKey | IUXBOOBSIDCBKN-BSFGQKQYSA-N |
| XLogP | 3.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|