C16H20O5 — CID 10827478
methyl 10-(oxan-2-yloxy)-7-oxodeca-2,8-diynoate (PubChem CID 10827478) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 10-(oxan-2-yloxy)-7-oxodeca-2,8-diynoate.
| Compound Name | methyl 10-(oxan-2-yloxy)-7-oxodeca-2,8-diynoate |
|---|---|
| PubChem CID | 10827478 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | methyl 10-(oxan-2-yloxy)-7-oxodeca-2,8-diynoate |
| SMILES | COC(=O)C#CCCCC(=O)C#CCOC1CCCCO1 |
| InChI | InChI=1S/C16H20O5/c1-19-15(18)10-4-2-3-8-14(17)9-7-13-21-16-11-5-6-12-20-16/h16H,2-3,5-6,8,11-13H2,1H3 |
| InChIKey | DKWODIQIRAQWOA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|