C15H15NO3 — CID 43334684
2-(1,3-benzodioxol-5-yl)-3-cyclopentyl-3-oxopropanenitrile (PubChem CID 43334684) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-cyclopentyl-3-oxopropanenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-cyclopentyl-3-oxopropanenitrile |
|---|---|
| PubChem CID | 43334684 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-cyclopentyl-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)C1CCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H15NO3/c16-8-12(15(17)10-3-1-2-4-10)11-5-6-13-14(7-11)19-9-18-13/h5-7,10,12H,1-4,9H2 |
| InChIKey | GYUJSIKNTAMFRF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |