C13H13NO5S — CID 104519579
2-(1,3-benzodioxol-5-yl)-4-methylsulfonyl-3-oxopentanenitrile (PubChem CID 104519579) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-methylsulfonyl-3-oxopentanenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-methylsulfonyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 104519579 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-methylsulfonyl-3-oxopentanenitrile |
| SMILES | CC(C(=O)C(C#N)c1ccc2c(c1)OCO2)S(C)(=O)=O |
| InChI | InChI=1S/C13H13NO5S/c1-8(20(2,16)17)13(15)10(6-14)9-3-4-11-12(5-9)19-7-18-11/h3-5,8,10H,7H2,1-2H3 |
| InChIKey | KQTNHVOCZPGCNQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |