C16H10INO3 — CID 43157156
2-(1,3-benzodioxol-5-yl)-3-(3-iodophenyl)-3-oxopropanenitrile (PubChem CID 43157156) has the molecular formula C16H10INO3 and a molecular weight of 391.16 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-(3-iodophenyl)-3-oxopropanenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-(3-iodophenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 43157156 |
| Molecular Formula | C16H10INO3 |
| Molecular Weight | 391.16 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-(3-iodophenyl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1cccc(I)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H10INO3/c17-12-3-1-2-11(6-12)16(19)13(8-18)10-4-5-14-15(7-10)21-9-20-14/h1-7,13H,9H2 |
| InChIKey | UHNAXOASBPIWBU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|