C15H10N2O3 — CID 80523896
3-(1,3-benzodioxol-5-yl)-3-oxo-2-pyridin-3-ylpropanenitrile (PubChem CID 80523896) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-oxo-2-pyridin-3-ylpropanenitrile.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-oxo-2-pyridin-3-ylpropanenitrile |
|---|---|
| PubChem CID | 80523896 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-oxo-2-pyridin-3-ylpropanenitrile |
| SMILES | N#CC(C(=O)c1ccc2c(c1)OCO2)c1cccnc1 |
| InChI | InChI=1S/C15H10N2O3/c16-7-12(11-2-1-5-17-8-11)15(18)10-3-4-13-14(6-10)20-9-19-13/h1-6,8,12H,9H2 |
| InChIKey | NXJFRYYGQZKVDJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |