C14H13NO3 — CID 55031918
2-(1,3-benzodioxol-5-yl)-4-cyclopropyl-3-oxobutanenitrile (PubChem CID 55031918) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-cyclopropyl-3-oxobutanenitrile.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-cyclopropyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 55031918 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-cyclopropyl-3-oxobutanenitrile |
| SMILES | N#CC(C(=O)CC1CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13NO3/c15-7-11(12(16)5-9-1-2-9)10-3-4-13-14(6-10)18-8-17-13/h3-4,6,9,11H,1-2,5,8H2 |
| InChIKey | LZXFDHBTDQAFQC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |