C14H19NO5S — CID 107758181
1-(1,3-benzodioxol-5-yl)-2-(2-methyloxolan-3-yl)sulfonylethanamine (PubChem CID 107758181) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2-methyloxolan-3-yl)sulfonylethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2-methyloxolan-3-yl)sulfonylethanamine |
|---|---|
| PubChem CID | 107758181 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2-methyloxolan-3-yl)sulfonylethanamine |
| SMILES | CC1OCCC1S(=O)(=O)CC(N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19NO5S/c1-9-14(4-5-18-9)21(16,17)7-11(15)10-2-3-12-13(6-10)20-8-19-12/h2-3,6,9,11,14H,4-5,7-8,15H2,1H3 |
| InChIKey | OYPXBDULASYBPN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |