C13H19NO5S — CID 64675655
1-(1,3-benzodioxol-5-yl)-2-(3-methoxypropylsulfonyl)ethanamine (PubChem CID 64675655) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(3-methoxypropylsulfonyl)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(3-methoxypropylsulfonyl)ethanamine |
|---|---|
| PubChem CID | 64675655 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(3-methoxypropylsulfonyl)ethanamine |
| SMILES | COCCCS(=O)(=O)CC(N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO5S/c1-17-5-2-6-20(15,16)8-11(14)10-3-4-12-13(7-10)19-9-18-12/h3-4,7,11H,2,5-6,8-9,14H2,1H3 |
| InChIKey | OZEUXVQUPFRHSO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|