C14H21NO5S — CID 18003684
[2-(2-aminophenyl)-2-(oxan-2-yloxy)ethyl] methanesulfonate (PubChem CID 18003684) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is [2-(2-aminophenyl)-2-(oxan-2-yloxy)ethyl] methanesulfonate.
| Compound Name | [2-(2-aminophenyl)-2-(oxan-2-yloxy)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 18003684 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [2-(2-aminophenyl)-2-(oxan-2-yloxy)ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(OC1CCCCO1)c1ccccc1N |
| InChI | InChI=1S/C14H21NO5S/c1-21(16,17)19-10-13(11-6-2-3-7-12(11)15)20-14-8-4-5-9-18-14/h2-3,6-7,13-14H,4-5,8-10,15H2,1H3 |
| InChIKey | IGALVPGQVULUBT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|