C22H45NO2Si2 — CID 11026012
(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enenitrile (PubChem CID 11026012) has the molecular formula C22H45NO2Si2 and a molecular weight of 411.78 g/mol. Its IUPAC name is (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enenitrile.
| Compound Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enenitrile |
|---|---|
| PubChem CID | 11026012 |
| Molecular Formula | C22H45NO2Si2 |
| Molecular Weight | 411.78 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enenitrile |
| SMILES | C=C[C@@H](C[C@@H](CC#N)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45NO2Si2/c1-13-20(24-26(11,12)22(8,9)10)16-21(14-15-23)25-27(17(2)3,18(4)5)19(6)7/h13,17-21H,1,14,16H2,2-12H3/t20-,21+/m0/s1 |
| InChIKey | ZXBJYHYVZLEIES-LEWJYISDSA-N |
| XLogP | 7.43 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|