C43H56O2Si3 — CID 139649655
[(4R,6S)-4,6-bis[[tert-butyl(diphenyl)silyl]oxy]oct-7-en-1-ynyl]-trimethylsilane (PubChem CID 139649655) has the molecular formula C43H56O2Si3 and a molecular weight of 689.18 g/mol. Its IUPAC name is [(4R,6S)-4,6-bis[[tert-butyl(diphenyl)silyl]oxy]oct-7-en-1-ynyl]-trimethylsilane.
| Compound Name | [(4R,6S)-4,6-bis[[tert-butyl(diphenyl)silyl]oxy]oct-7-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 139649655 |
| Molecular Formula | C43H56O2Si3 |
| Molecular Weight | 689.18 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | [(4R,6S)-4,6-bis[[tert-butyl(diphenyl)silyl]oxy]oct-7-en-1-ynyl]-trimethylsilane |
| SMILES | C=C[C@H](C[C@@H](CC#C[Si](C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H56O2Si3/c1-11-36(44-47(42(2,3)4,38-26-16-12-17-27-38)39-28-18-13-19-29-39)35-37(25-24-34-46(8,9)10)45-48(43(5,6)7,40-30-20-14-21-31-40)41-32-22-15-23-33-41/h11-23,26-33,36-37H,1,25,35H2,2-10H3/t36-,37-/m1/s1 |
| InChIKey | XYEUBNOAABQUBC-FZNHDDJXSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.18 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|