C27H39NO3Si — CID 67134844
propan-2-yl N-[(3R)-5-[tert-butyl(diphenyl)silyl]oxyhept-6-en-3-yl]carbamate (PubChem CID 67134844) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is propan-2-yl N-[(3R)-5-[tert-butyl(diphenyl)silyl]oxyhept-6-en-3-yl]carbamate.
| Compound Name | propan-2-yl N-[(3R)-5-[tert-butyl(diphenyl)silyl]oxyhept-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 67134844 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | propan-2-yl N-[(3R)-5-[tert-butyl(diphenyl)silyl]oxyhept-6-en-3-yl]carbamate |
| SMILES | C=CC(C[C@@H](CC)NC(=O)OC(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H39NO3Si/c1-8-22(28-26(29)30-21(3)4)20-23(9-2)31-32(27(5,6)7,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h9-19,21-23H,2,8,20H2,1,3-7H3,(H,28,29)/t22-,23?/m1/s1 |
| InChIKey | NNPDMDCECJKQTA-WTQRLHSKSA-N |
| XLogP | 5.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|