C25H32Cl3NO2Si — CID 11318238
N-[(3R,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]-2,2,2-trichloroacetamide (PubChem CID 11318238) has the molecular formula C25H32Cl3NO2Si and a molecular weight of 512.98 g/mol. Its IUPAC name is N-[(3R,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(3R,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 11318238 |
| Molecular Formula | C25H32Cl3NO2Si |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-[(3R,4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]-2,2,2-trichloroacetamide |
| SMILES | C=C[C@@H](NC(=O)C(Cl)(Cl)Cl)[C@H](C)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32Cl3NO2Si/c1-7-22(29-23(30)25(26,27)28)18(2)19(3)31-32(24(4,5)6,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h7-19,22H,1H2,2-6H3,(H,29,30)/t18-,19-,22-/m1/s1 |
| InChIKey | ODFDUIGCCWFQBS-WOIUINJBSA-N |
| XLogP | 5.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|