C18H23Cl3N2O3 — CID 14931010
tert-butyl N-[(2S,3R)-1-phenyl-3-[(2,2,2-trichloroacetyl)amino]pent-4-en-2-yl]carbamate (PubChem CID 14931010) has the molecular formula C18H23Cl3N2O3 and a molecular weight of 421.75 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1-phenyl-3-[(2,2,2-trichloroacetyl)amino]pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1-phenyl-3-[(2,2,2-trichloroacetyl)amino]pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 14931010 |
| Molecular Formula | C18H23Cl3N2O3 |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1-phenyl-3-[(2,2,2-trichloroacetyl)amino]pent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](NC(=O)C(Cl)(Cl)Cl)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23Cl3N2O3/c1-5-13(22-15(24)18(19,20)21)14(11-12-9-7-6-8-10-12)23-16(25)26-17(2,3)4/h5-10,13-14H,1,11H2,2-4H3,(H,22,24)(H,23,25)/t13-,14+/m1/s1 |
| InChIKey | GYFYYKOKTAKYJX-KGLIPLIRSA-N |
| XLogP | 4.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|